About benzyl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate
benzyl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate (PubChem CID 24970436) has the molecular formula C19H16N4O2S
and a molecular weight of 364.43 g/mol. Its IUPAC name is benzyl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate.
Molecular Properties
| Compound Name | benzyl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate |
| PubChem CID | 24970436 |
| Molecular Formula | C19H16N4O2S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | benzyl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate |
| SMILES | [H]/N=C(\OCc1ccccc1)c1nc2ccc3ncn(CC)c(=O)c3c2s1 |
| InChI | InChI=1S/C19H16N4O2S/c1-2-23-11-21-13-8-9-14-16(15(13)19(23)24)26-18(22-14)17(20)25-10-12-6-4-3-5-7-12/h3-9,11,20H,2,10H2,1H3/b20-17- |
| InChIKey | WSUSQFQQODISNM-JZJYNLBNSA-N |
| XLogP | 3.57 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate?
The IUPAC name of benzyl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate (CID 24970436) is benzyl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate.
What is the SMILES notation for benzyl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate?
The canonical SMILES for benzyl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate is [H]/N=C(\OCc1ccccc1)c1nc2ccc3ncn(CC)c(=O)c3c2s1.
What is the InChIKey of benzyl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate?
The InChIKey is WSUSQFQQODISNM-JZJYNLBNSA-N. The full InChI is InChI=1S/C19H16N4O2S/c1-2-23-11-21-13-8-9-14-16(15(13)19(23)24)26-18(22-14)17(20)25-10-12-6-4-3-5-7-12/h3-9,11,20H,2,10H2,1H3/b20-17-.
What are the key properties of benzyl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate?
benzyl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate has a molecular weight of 364.43 g/mol, XLogP of 3.57, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate is sourced from PubChem (CID 24970436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).