C21H34O5 — CID 24970576
methyl 2-[(1R,3S,4E,7E,11S,12R)-3,11,12-trihydroxy-4,8,12-trimethylcyclotetradeca-4,7-dien-1-yl]prop-2-enoate (PubChem CID 24970576) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is methyl 2-[(1R,3S,4E,7E,11S,12R)-3,11,12-trihydroxy-4,8,12-trimethylcyclotetradeca-4,7-dien-1-yl]prop-2-enoate.
| Compound Name | methyl 2-[(1R,3S,4E,7E,11S,12R)-3,11,12-trihydroxy-4,8,12-trimethylcyclotetradeca-4,7-dien-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 24970576 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | methyl 2-[(1R,3S,4E,7E,11S,12R)-3,11,12-trihydroxy-4,8,12-trimethylcyclotetradeca-4,7-dien-1-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CC[C@@](C)(O)[C@@H](O)CC/C(C)=C/C/C=C(\C)[C@@H](O)C1 |
| InChI | InChI=1S/C21H34O5/c1-14-7-6-8-15(2)18(22)13-17(16(3)20(24)26-5)11-12-21(4,25)19(23)10-9-14/h7-8,17-19,22-23,25H,3,6,9-13H2,1-2,4-5H3/b14-7+,15-8+/t17-,18+,19+,21-/m1/s1 |
| InChIKey | NULPWFRFJXKLME-BJLPOFMISA-N |
| XLogP | 3.05 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|