About 5,6-dichloro-N-(3,4-dichlorophenyl)-1H-benzimidazol-2-amine
5,6-dichloro-N-(3,4-dichlorophenyl)-1H-benzimidazol-2-amine (PubChem CID 24970680) has the molecular formula C13H7Cl4N3
and a molecular weight of 347.03 g/mol. Its IUPAC name is 5,6-dichloro-N-(3,4-dichlorophenyl)-1H-benzimidazol-2-amine.
Molecular Properties
| Compound Name | 5,6-dichloro-N-(3,4-dichlorophenyl)-1H-benzimidazol-2-amine |
| PubChem CID | 24970680 |
| Molecular Formula | C13H7Cl4N3 |
| Molecular Weight | 347.03 g/mol |
| Exact Mass | 344.94 |
| IUPAC Name | 5,6-dichloro-N-(3,4-dichlorophenyl)-1H-benzimidazol-2-amine |
| SMILES | Clc1ccc(Nc2nc3cc(Cl)c(Cl)cc3[nH]2)cc1Cl |
| InChI | InChI=1S/C13H7Cl4N3/c14-7-2-1-6(3-8(7)15)18-13-19-11-4-9(16)10(17)5-12(11)20-13/h1-5H,(H2,18,19,20) |
| InChIKey | OGRMLWZQTQLAAX-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.03 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dichloro-N-(3,4-dichlorophenyl)-1H-benzimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dichloro-N-(3,4-dichlorophenyl)-1H-benzimidazol-2-amine?
The IUPAC name of 5,6-dichloro-N-(3,4-dichlorophenyl)-1H-benzimidazol-2-amine (CID 24970680) is 5,6-dichloro-N-(3,4-dichlorophenyl)-1H-benzimidazol-2-amine.
What is the SMILES notation for 5,6-dichloro-N-(3,4-dichlorophenyl)-1H-benzimidazol-2-amine?
The canonical SMILES for 5,6-dichloro-N-(3,4-dichlorophenyl)-1H-benzimidazol-2-amine is Clc1ccc(Nc2nc3cc(Cl)c(Cl)cc3[nH]2)cc1Cl.
What is the InChIKey of 5,6-dichloro-N-(3,4-dichlorophenyl)-1H-benzimidazol-2-amine?
The InChIKey is OGRMLWZQTQLAAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7Cl4N3/c14-7-2-1-6(3-8(7)15)18-13-19-11-4-9(16)10(17)5-12(11)20-13/h1-5H,(H2,18,19,20).
What are the key properties of 5,6-dichloro-N-(3,4-dichlorophenyl)-1H-benzimidazol-2-amine?
5,6-dichloro-N-(3,4-dichlorophenyl)-1H-benzimidazol-2-amine has a molecular weight of 347.03 g/mol, XLogP of 5.92, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dichloro-N-(3,4-dichlorophenyl)-1H-benzimidazol-2-amine is sourced from PubChem (CID 24970680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).