C18H20O3 — CID 24970696
1,4,4,6,9-pentamethyl-1,2-dihydrobenzo[f]isochromene-7,8-dione (PubChem CID 24970696) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is 1,4,4,6,9-pentamethyl-1,2-dihydrobenzo[f]isochromene-7,8-dione.
| Compound Name | 1,4,4,6,9-pentamethyl-1,2-dihydrobenzo[f]isochromene-7,8-dione |
|---|---|
| PubChem CID | 24970696 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 1,4,4,6,9-pentamethyl-1,2-dihydrobenzo[f]isochromene-7,8-dione |
| SMILES | CC1=Cc2c(c(C)cc3c2C(C)COC3(C)C)C(=O)C1=O |
| InChI | InChI=1S/C18H20O3/c1-9-7-13-14(11(3)8-21-18(13,4)5)12-6-10(2)16(19)17(20)15(9)12/h6-7,11H,8H2,1-5H3 |
| InChIKey | LKKQCDCZGYUJTA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|