C33H44N4O8 — CID 24970743
ethyl (Z)-2-[[(2S)-2-[[(2S)-3-hydroxy-2-[[(2S)-2-[(3-hydroxy-2-methylbenzoyl)amino]-3-methylbutanoyl]amino]propanoyl]amino]-4-methylpentanoyl]amino]-3-phenylprop-2-enoate (PubChem CID 24970743) has the molecular formula C33H44N4O8 and a molecular weight of 624.74 g/mol. Its IUPAC name is ethyl (Z)-2-[[(2S)-2-[[(2S)-3-hydroxy-2-[[(2S)-2-[(3-hydroxy-2-methylbenzoyl)amino]-3-methylbutanoyl]amino]propanoyl]amino]-4-methylpentanoyl]amino]-3-phenylprop-2-enoate.
| Compound Name | ethyl (Z)-2-[[(2S)-2-[[(2S)-3-hydroxy-2-[[(2S)-2-[(3-hydroxy-2-methylbenzoyl)amino]-3-methylbutanoyl]amino]propanoyl]amino]-4-methylpentanoyl]amino]-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 24970743 |
| Molecular Formula | C33H44N4O8 |
| Molecular Weight | 624.74 g/mol |
| Exact Mass | 624.32 |
| IUPAC Name | ethyl (Z)-2-[[(2S)-2-[[(2S)-3-hydroxy-2-[[(2S)-2-[(3-hydroxy-2-methylbenzoyl)amino]-3-methylbutanoyl]amino]propanoyl]amino]-4-methylpentanoyl]amino]-3-phenylprop-2-enoate |
| SMILES | CCOC(=O)/C(=C/c1ccccc1)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)c1cccc(O)c1C)C(C)C |
| InChI | InChI=1S/C33H44N4O8/c1-7-45-33(44)25(17-22-12-9-8-10-13-22)35-30(41)24(16-19(2)3)34-31(42)26(18-38)36-32(43)28(20(4)5)37-29(40)23-14-11-15-27(39)21(23)6/h8-15,17,19-20,24,26,28,38-39H,7,16,18H2,1-6H3,(H,34,42)(H,35,41)(H,36,43)(H,37,40)/b25-17-/t24-,26-,28-/m0/s1 |
| InChIKey | LNHXMJJAAUOWAB-HGSJSZSLSA-N |
| XLogP | 2.18 |
| TPSA | 183.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.74 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|