C20H24O5 — CID 24970921
(1R,3E,5S,9R,13R)-13-hydroxy-3-methyl-8,12-dimethylidene-6,18-dioxatricyclo[14.2.1.05,9]nonadeca-3,16(19)-diene-7,17-dione (PubChem CID 24970921) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (1R,3E,5S,9R,13R)-13-hydroxy-3-methyl-8,12-dimethylidene-6,18-dioxatricyclo[14.2.1.05,9]nonadeca-3,16(19)-diene-7,17-dione.
| Compound Name | (1R,3E,5S,9R,13R)-13-hydroxy-3-methyl-8,12-dimethylidene-6,18-dioxatricyclo[14.2.1.05,9]nonadeca-3,16(19)-diene-7,17-dione |
|---|---|
| PubChem CID | 24970921 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (1R,3E,5S,9R,13R)-13-hydroxy-3-methyl-8,12-dimethylidene-6,18-dioxatricyclo[14.2.1.05,9]nonadeca-3,16(19)-diene-7,17-dione |
| SMILES | C=C1CC[C@@H]2C(=C)C(=O)O[C@H]2/C=C(\C)C[C@@H]2C=C(CC[C@H]1O)C(=O)O2 |
| InChI | InChI=1S/C20H24O5/c1-11-8-15-10-14(20(23)24-15)5-7-17(21)12(2)4-6-16-13(3)19(22)25-18(16)9-11/h9-10,15-18,21H,2-8H2,1H3/b11-9+/t15-,16-,17-,18+/m1/s1 |
| InChIKey | VOJUAGSYDJPMCX-JUXQZVFASA-N |
| XLogP | 2.76 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|