C25H35NO4 — CID 24971194
tert-butyl (2R,3R)-2-[(1E,3E,5R,6R)-6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dienyl]-3-methyl-4-oxoazetidine-1-carboxylate (PubChem CID 24971194) has the molecular formula C25H35NO4 and a molecular weight of 413.56 g/mol. Its IUPAC name is tert-butyl (2R,3R)-2-[(1E,3E,5R,6R)-6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dienyl]-3-methyl-4-oxoazetidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R)-2-[(1E,3E,5R,6R)-6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dienyl]-3-methyl-4-oxoazetidine-1-carboxylate |
|---|---|
| PubChem CID | 24971194 |
| Molecular Formula | C25H35NO4 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | tert-butyl (2R,3R)-2-[(1E,3E,5R,6R)-6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dienyl]-3-methyl-4-oxoazetidine-1-carboxylate |
| SMILES | CO[C@H](Cc1ccccc1)[C@H](C)/C=C(C)/C=C/[C@@H]1[C@@H](C)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H35NO4/c1-17(15-18(2)22(29-7)16-20-11-9-8-10-12-20)13-14-21-19(3)23(27)26(21)24(28)30-25(4,5)6/h8-15,18-19,21-22H,16H2,1-7H3/b14-13+,17-15+/t18-,19-,21-,22-/m1/s1 |
| InChIKey | JZVHAXOPDMJOSI-IWZNKZMSSA-N |
| XLogP | 5.16 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|