C23H34O8 — CID 24971201
tetraethyl (5E)-4-methylidene-5-(2-methylpropylidene)cyclohexane-1,1,2,2-tetracarboxylate (PubChem CID 24971201) has the molecular formula C23H34O8 and a molecular weight of 438.52 g/mol. Its IUPAC name is tetraethyl (5E)-4-methylidene-5-(2-methylpropylidene)cyclohexane-1,1,2,2-tetracarboxylate.
| Compound Name | tetraethyl (5E)-4-methylidene-5-(2-methylpropylidene)cyclohexane-1,1,2,2-tetracarboxylate |
|---|---|
| PubChem CID | 24971201 |
| Molecular Formula | C23H34O8 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | tetraethyl (5E)-4-methylidene-5-(2-methylpropylidene)cyclohexane-1,1,2,2-tetracarboxylate |
| SMILES | C=C1CC(C(=O)OCC)(C(=O)OCC)C(C(=O)OCC)(C(=O)OCC)C/C1=C\C(C)C |
| InChI | InChI=1S/C23H34O8/c1-8-28-18(24)22(19(25)29-9-2)13-16(7)17(12-15(5)6)14-23(22,20(26)30-10-3)21(27)31-11-4/h12,15H,7-11,13-14H2,1-6H3/b17-12+ |
| InChIKey | MQACJASGCNUWAE-SFQUDFHCSA-N |
| XLogP | 3.14 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|