About 2-(4-chloro-2,6-dimethoxyphenyl)-4-methoxy-6-methyl-5-pentan-3-yloxypyrimidine
2-(4-chloro-2,6-dimethoxyphenyl)-4-methoxy-6-methyl-5-pentan-3-yloxypyrimidine (PubChem CID 24971237) has the molecular formula C19H25ClN2O4
and a molecular weight of 380.87 g/mol. Its IUPAC name is 2-(4-chloro-2,6-dimethoxyphenyl)-4-methoxy-6-methyl-5-pentan-3-yloxypyrimidine.
Molecular Properties
| Compound Name | 2-(4-chloro-2,6-dimethoxyphenyl)-4-methoxy-6-methyl-5-pentan-3-yloxypyrimidine |
| PubChem CID | 24971237 |
| Molecular Formula | C19H25ClN2O4 |
| Molecular Weight | 380.87 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 2-(4-chloro-2,6-dimethoxyphenyl)-4-methoxy-6-methyl-5-pentan-3-yloxypyrimidine |
| SMILES | CCC(CC)Oc1c(C)nc(-c2c(OC)cc(Cl)cc2OC)nc1OC |
| InChI | InChI=1S/C19H25ClN2O4/c1-7-13(8-2)26-17-11(3)21-18(22-19(17)25-6)16-14(23-4)9-12(20)10-15(16)24-5/h9-10,13H,7-8H2,1-6H3 |
| InChIKey | KYWWMZUBZXRENK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.87 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-chloro-2,6-dimethoxyphenyl)-4-methoxy-6-methyl-5-pentan-3-yloxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-2,6-dimethoxyphenyl)-4-methoxy-6-methyl-5-pentan-3-yloxypyrimidine?
The IUPAC name of 2-(4-chloro-2,6-dimethoxyphenyl)-4-methoxy-6-methyl-5-pentan-3-yloxypyrimidine (CID 24971237) is 2-(4-chloro-2,6-dimethoxyphenyl)-4-methoxy-6-methyl-5-pentan-3-yloxypyrimidine.
What is the SMILES notation for 2-(4-chloro-2,6-dimethoxyphenyl)-4-methoxy-6-methyl-5-pentan-3-yloxypyrimidine?
The canonical SMILES for 2-(4-chloro-2,6-dimethoxyphenyl)-4-methoxy-6-methyl-5-pentan-3-yloxypyrimidine is CCC(CC)Oc1c(C)nc(-c2c(OC)cc(Cl)cc2OC)nc1OC.
What is the InChIKey of 2-(4-chloro-2,6-dimethoxyphenyl)-4-methoxy-6-methyl-5-pentan-3-yloxypyrimidine?
The InChIKey is KYWWMZUBZXRENK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25ClN2O4/c1-7-13(8-2)26-17-11(3)21-18(22-19(17)25-6)16-14(23-4)9-12(20)10-15(16)24-5/h9-10,13H,7-8H2,1-6H3.
What are the key properties of 2-(4-chloro-2,6-dimethoxyphenyl)-4-methoxy-6-methyl-5-pentan-3-yloxypyrimidine?
2-(4-chloro-2,6-dimethoxyphenyl)-4-methoxy-6-methyl-5-pentan-3-yloxypyrimidine has a molecular weight of 380.87 g/mol, XLogP of 4.70, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-2,6-dimethoxyphenyl)-4-methoxy-6-methyl-5-pentan-3-yloxypyrimidine is sourced from PubChem (CID 24971237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).