C24H29ClN4O2S — CID 24971278
ethyl 2-[4-chloro-6-(quinolin-6-ylmethylamino)pyrimidin-2-yl]sulfanyloctanoate (PubChem CID 24971278) has the molecular formula C24H29ClN4O2S and a molecular weight of 473.04 g/mol. Its IUPAC name is ethyl 2-[4-chloro-6-(quinolin-6-ylmethylamino)pyrimidin-2-yl]sulfanyloctanoate.
| Compound Name | ethyl 2-[4-chloro-6-(quinolin-6-ylmethylamino)pyrimidin-2-yl]sulfanyloctanoate |
|---|---|
| PubChem CID | 24971278 |
| Molecular Formula | C24H29ClN4O2S |
| Molecular Weight | 473.04 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | ethyl 2-[4-chloro-6-(quinolin-6-ylmethylamino)pyrimidin-2-yl]sulfanyloctanoate |
| SMILES | CCCCCCC(Sc1nc(Cl)cc(NCc2ccc3ncccc3c2)n1)C(=O)OCC |
| InChI | InChI=1S/C24H29ClN4O2S/c1-3-5-6-7-10-20(23(30)31-4-2)32-24-28-21(25)15-22(29-24)27-16-17-11-12-19-18(14-17)9-8-13-26-19/h8-9,11-15,20H,3-7,10,16H2,1-2H3,(H,27,28,29) |
| InChIKey | BFCFGUPNXICZMR-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.04 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|