C32H49NO5 — CID 24971287
[(E,2S)-1-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]tridec-5-en-2-yl] (2S)-2-formamido-3-phenylpropanoate (PubChem CID 24971287) has the molecular formula C32H49NO5 and a molecular weight of 527.75 g/mol. Its IUPAC name is [(E,2S)-1-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]tridec-5-en-2-yl] (2S)-2-formamido-3-phenylpropanoate.
| Compound Name | [(E,2S)-1-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]tridec-5-en-2-yl] (2S)-2-formamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 24971287 |
| Molecular Formula | C32H49NO5 |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.36 |
| IUPAC Name | [(E,2S)-1-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]tridec-5-en-2-yl] (2S)-2-formamido-3-phenylpropanoate |
| SMILES | CCCCCCC/C=C/CC[C@@H](C[C@@H]1OC(=O)[C@H]1CCCCCC)OC(=O)[C@H](Cc1ccccc1)NC=O |
| InChI | InChI=1S/C32H49NO5/c1-3-5-7-9-10-11-12-13-17-21-27(24-30-28(31(35)38-30)22-18-8-6-4-2)37-32(36)29(33-25-34)23-26-19-15-14-16-20-26/h12-16,19-20,25,27-30H,3-11,17-18,21-24H2,1-2H3,(H,33,34)/b13-12+/t27-,28-,29-,30-/m0/s1 |
| InChIKey | CHBMTUAOXUPFDI-KQFBEPMRSA-N |
| XLogP | 6.85 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|