About 1-(4,6-dipyridin-3-yl-1H-benzimidazol-2-yl)-3-ethylurea
1-(4,6-dipyridin-3-yl-1H-benzimidazol-2-yl)-3-ethylurea (PubChem CID 24971305) has the molecular formula C20H18N6O
and a molecular weight of 358.41 g/mol. Its IUPAC name is 1-(4,6-dipyridin-3-yl-1H-benzimidazol-2-yl)-3-ethylurea.
Molecular Properties
| Compound Name | 1-(4,6-dipyridin-3-yl-1H-benzimidazol-2-yl)-3-ethylurea |
| PubChem CID | 24971305 |
| Molecular Formula | C20H18N6O |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-(4,6-dipyridin-3-yl-1H-benzimidazol-2-yl)-3-ethylurea |
| SMILES | CCNC(=O)Nc1nc2c(-c3cccnc3)cc(-c3cccnc3)cc2[nH]1 |
| InChI | InChI=1S/C20H18N6O/c1-2-23-20(27)26-19-24-17-10-15(13-5-3-7-21-11-13)9-16(18(17)25-19)14-6-4-8-22-12-14/h3-12H,2H2,1H3,(H3,23,24,25,26,27) |
| InChIKey | CWLNVKFAQINOMH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4,6-dipyridin-3-yl-1H-benzimidazol-2-yl)-3-ethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,6-dipyridin-3-yl-1H-benzimidazol-2-yl)-3-ethylurea?
The IUPAC name of 1-(4,6-dipyridin-3-yl-1H-benzimidazol-2-yl)-3-ethylurea (CID 24971305) is 1-(4,6-dipyridin-3-yl-1H-benzimidazol-2-yl)-3-ethylurea.
What is the SMILES notation for 1-(4,6-dipyridin-3-yl-1H-benzimidazol-2-yl)-3-ethylurea?
The canonical SMILES for 1-(4,6-dipyridin-3-yl-1H-benzimidazol-2-yl)-3-ethylurea is CCNC(=O)Nc1nc2c(-c3cccnc3)cc(-c3cccnc3)cc2[nH]1.
What is the InChIKey of 1-(4,6-dipyridin-3-yl-1H-benzimidazol-2-yl)-3-ethylurea?
The InChIKey is CWLNVKFAQINOMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N6O/c1-2-23-20(27)26-19-24-17-10-15(13-5-3-7-21-11-13)9-16(18(17)25-19)14-6-4-8-22-12-14/h3-12H,2H2,1H3,(H3,23,24,25,26,27).
What are the key properties of 1-(4,6-dipyridin-3-yl-1H-benzimidazol-2-yl)-3-ethylurea?
1-(4,6-dipyridin-3-yl-1H-benzimidazol-2-yl)-3-ethylurea has a molecular weight of 358.41 g/mol, XLogP of 3.83, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,6-dipyridin-3-yl-1H-benzimidazol-2-yl)-3-ethylurea is sourced from PubChem (CID 24971305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).