About N-cyclohexyl-4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide
N-cyclohexyl-4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide (PubChem CID 24971319) has the molecular formula C17H18F2N4O2
and a molecular weight of 348.35 g/mol. Its IUPAC name is N-cyclohexyl-4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | N-cyclohexyl-4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide |
| PubChem CID | 24971319 |
| Molecular Formula | C17H18F2N4O2 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N-cyclohexyl-4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1[nH]ncc1NC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C17H18F2N4O2/c18-11-7-4-8-12(19)14(11)16(24)22-13-9-20-23-15(13)17(25)21-10-5-2-1-3-6-10/h4,7-10H,1-3,5-6H2,(H,20,23)(H,21,25)(H,22,24) |
| InChIKey | GJHVXBPCYTULDM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclohexyl-4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide?
The IUPAC name of N-cyclohexyl-4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide (CID 24971319) is N-cyclohexyl-4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide.
What is the SMILES notation for N-cyclohexyl-4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide?
The canonical SMILES for N-cyclohexyl-4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide is O=C(NC1CCCCC1)c1[nH]ncc1NC(=O)c1c(F)cccc1F.
What is the InChIKey of N-cyclohexyl-4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide?
The InChIKey is GJHVXBPCYTULDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18F2N4O2/c18-11-7-4-8-12(19)14(11)16(24)22-13-9-20-23-15(13)17(25)21-10-5-2-1-3-6-10/h4,7-10H,1-3,5-6H2,(H,20,23)(H,21,25)(H,22,24).
What are the key properties of N-cyclohexyl-4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide?
N-cyclohexyl-4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide has a molecular weight of 348.35 g/mol, XLogP of 3.00, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide is sourced from PubChem (CID 24971319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).