C27H46N10O4 — CID 24971360
(2S)-6-amino-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[[(2S)-6-(diaminomethylideneamino)-2-[(2-phenylacetyl)amino]hexanoyl]amino]hexanamide (PubChem CID 24971360) has the molecular formula C27H46N10O4 and a molecular weight of 574.73 g/mol. Its IUPAC name is (2S)-6-amino-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[[(2S)-6-(diaminomethylideneamino)-2-[(2-phenylacetyl)amino]hexanoyl]amino]hexanamide.
| Compound Name | (2S)-6-amino-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[[(2S)-6-(diaminomethylideneamino)-2-[(2-phenylacetyl)amino]hexanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 24971360 |
| Molecular Formula | C27H46N10O4 |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 574.37 |
| IUPAC Name | (2S)-6-amino-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[[(2S)-6-(diaminomethylideneamino)-2-[(2-phenylacetyl)amino]hexanoyl]amino]hexanamide |
| SMILES | NCCCC[C@H](NC(=O)[C@H](CCCCN=C(N)N)NC(=O)Cc1ccccc1)C(=O)N[C@H](C=O)CCCN=C(N)N |
| InChI | InChI=1S/C27H46N10O4/c28-14-6-4-12-22(24(40)35-20(18-38)11-8-16-34-27(31)32)37-25(41)21(13-5-7-15-33-26(29)30)36-23(39)17-19-9-2-1-3-10-19/h1-3,9-10,18,20-22H,4-8,11-17,28H2,(H,35,40)(H,36,39)(H,37,41)(H4,29,30,33)(H4,31,32,34)/t20-,21-,22-/m0/s1 |
| InChIKey | NEFZBDYSATZNQW-FKBYEOEOSA-N |
| XLogP | -1.49 |
| TPSA | 259.19 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|