C7H8FNO — CID 24971814
3-fluoro-2,6-dimethyl-1H-pyridin-4-one (PubChem CID 24971814) has the molecular formula C7H8FNO and a molecular weight of 141.14 g/mol. Its IUPAC name is 3-fluoro-2,6-dimethyl-1H-pyridin-4-one.
| Compound Name | 3-fluoro-2,6-dimethyl-1H-pyridin-4-one |
|---|---|
| PubChem CID | 24971814 |
| Molecular Formula | C7H8FNO |
| Molecular Weight | 141.14 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 3-fluoro-2,6-dimethyl-1H-pyridin-4-one |
| SMILES | Cc1cc(=O)c(F)c(C)[nH]1 |
| InChI | InChI=1S/C7H8FNO/c1-4-3-6(10)7(8)5(2)9-4/h3H,1-2H3,(H,9,10) |
| InChIKey | PBEYVPDBACMUBQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.14 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |