About 3-bromoimidazo[1,2-a]pyrazin-2-amine
3-bromoimidazo[1,2-a]pyrazin-2-amine (PubChem CID 24971926) has the molecular formula C6H5BrN4
and a molecular weight of 213.04 g/mol. Its IUPAC name is 3-bromoimidazo[1,2-a]pyrazin-2-amine.
Molecular Properties
| Compound Name | 3-bromoimidazo[1,2-a]pyrazin-2-amine |
| PubChem CID | 24971926 |
| Molecular Formula | C6H5BrN4 |
| Molecular Weight | 213.04 g/mol |
| Exact Mass | 211.97 |
| IUPAC Name | 3-bromoimidazo[1,2-a]pyrazin-2-amine |
| SMILES | Nc1nc2cnccn2c1Br |
| InChI | InChI=1S/C6H5BrN4/c7-5-6(8)10-4-3-9-1-2-11(4)5/h1-3H,8H2 |
| InChIKey | FNMQUUIDFLUPOV-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.04 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromoimidazo[1,2-a]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromoimidazo[1,2-a]pyrazin-2-amine?
The IUPAC name of 3-bromoimidazo[1,2-a]pyrazin-2-amine (CID 24971926) is 3-bromoimidazo[1,2-a]pyrazin-2-amine.
What is the SMILES notation for 3-bromoimidazo[1,2-a]pyrazin-2-amine?
The canonical SMILES for 3-bromoimidazo[1,2-a]pyrazin-2-amine is Nc1nc2cnccn2c1Br.
What is the InChIKey of 3-bromoimidazo[1,2-a]pyrazin-2-amine?
The InChIKey is FNMQUUIDFLUPOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrN4/c7-5-6(8)10-4-3-9-1-2-11(4)5/h1-3H,8H2.
What are the key properties of 3-bromoimidazo[1,2-a]pyrazin-2-amine?
3-bromoimidazo[1,2-a]pyrazin-2-amine has a molecular weight of 213.04 g/mol, XLogP of 1.07, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromoimidazo[1,2-a]pyrazin-2-amine is sourced from PubChem (CID 24971926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).