About diphenyl(phenylimino)-λ4-sulfane
diphenyl(phenylimino)-λ4-sulfane (PubChem CID 24972411) has the molecular formula C18H15NS
and a molecular weight of 277.39 g/mol. Its IUPAC name is diphenyl(phenylimino)-λ4-sulfane.
Molecular Properties
| Compound Name | diphenyl(phenylimino)-λ4-sulfane |
| PubChem CID | 24972411 |
| Molecular Formula | C18H15NS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | diphenyl(phenylimino)-λ4-sulfane |
| SMILES | c1ccc(N=S(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15NS/c1-4-10-16(11-5-1)19-20(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| InChIKey | HKDKYYWDLYAINH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze diphenyl(phenylimino)-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl(phenylimino)-λ4-sulfane?
The IUPAC name of diphenyl(phenylimino)-λ4-sulfane (CID 24972411) is diphenyl(phenylimino)-λ4-sulfane.
What is the SMILES notation for diphenyl(phenylimino)-λ4-sulfane?
The canonical SMILES for diphenyl(phenylimino)-λ4-sulfane is c1ccc(N=S(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of diphenyl(phenylimino)-λ4-sulfane?
The InChIKey is HKDKYYWDLYAINH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NS/c1-4-10-16(11-5-1)19-20(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H.
What are the key properties of diphenyl(phenylimino)-λ4-sulfane?
diphenyl(phenylimino)-λ4-sulfane has a molecular weight of 277.39 g/mol, XLogP of 5.24, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl(phenylimino)-λ4-sulfane is sourced from PubChem (CID 24972411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).