About methylimino(diphenyl)-λ4-sulfane
methylimino(diphenyl)-λ4-sulfane (PubChem CID 24972412) has the molecular formula C13H13NS
and a molecular weight of 215.32 g/mol. Its IUPAC name is methylimino(diphenyl)-λ4-sulfane.
Molecular Properties
| Compound Name | methylimino(diphenyl)-λ4-sulfane |
| PubChem CID | 24972412 |
| Molecular Formula | C13H13NS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | methylimino(diphenyl)-λ4-sulfane |
| SMILES | CN=S(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H13NS/c1-14-15(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3 |
| InChIKey | MFWFVZPDJVKOQI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methylimino(diphenyl)-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylimino(diphenyl)-λ4-sulfane?
The IUPAC name of methylimino(diphenyl)-λ4-sulfane (CID 24972412) is methylimino(diphenyl)-λ4-sulfane.
What is the SMILES notation for methylimino(diphenyl)-λ4-sulfane?
The canonical SMILES for methylimino(diphenyl)-λ4-sulfane is CN=S(c1ccccc1)c1ccccc1.
What is the InChIKey of methylimino(diphenyl)-λ4-sulfane?
The InChIKey is MFWFVZPDJVKOQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NS/c1-14-15(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3.
What are the key properties of methylimino(diphenyl)-λ4-sulfane?
methylimino(diphenyl)-λ4-sulfane has a molecular weight of 215.32 g/mol, XLogP of 3.54, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methylimino(diphenyl)-λ4-sulfane is sourced from PubChem (CID 24972412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).