About 5-(1-methoxyethenyl)-3,3-dimethylcyclohexan-1-one
5-(1-methoxyethenyl)-3,3-dimethylcyclohexan-1-one (PubChem CID 24972428) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is 5-(1-methoxyethenyl)-3,3-dimethylcyclohexan-1-one.
Molecular Properties
| Compound Name | 5-(1-methoxyethenyl)-3,3-dimethylcyclohexan-1-one |
| PubChem CID | 24972428 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 5-(1-methoxyethenyl)-3,3-dimethylcyclohexan-1-one |
| SMILES | C=C(OC)C1CC(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C11H18O2/c1-8(13-4)9-5-10(12)7-11(2,3)6-9/h9H,1,5-7H2,2-4H3 |
| InChIKey | CQFCJTKVZCICHU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-methoxyethenyl)-3,3-dimethylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-methoxyethenyl)-3,3-dimethylcyclohexan-1-one?
The IUPAC name of 5-(1-methoxyethenyl)-3,3-dimethylcyclohexan-1-one (CID 24972428) is 5-(1-methoxyethenyl)-3,3-dimethylcyclohexan-1-one.
What is the SMILES notation for 5-(1-methoxyethenyl)-3,3-dimethylcyclohexan-1-one?
The canonical SMILES for 5-(1-methoxyethenyl)-3,3-dimethylcyclohexan-1-one is C=C(OC)C1CC(=O)CC(C)(C)C1.
What is the InChIKey of 5-(1-methoxyethenyl)-3,3-dimethylcyclohexan-1-one?
The InChIKey is CQFCJTKVZCICHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2/c1-8(13-4)9-5-10(12)7-11(2,3)6-9/h9H,1,5-7H2,2-4H3.
What are the key properties of 5-(1-methoxyethenyl)-3,3-dimethylcyclohexan-1-one?
5-(1-methoxyethenyl)-3,3-dimethylcyclohexan-1-one has a molecular weight of 182.26 g/mol, XLogP of 2.54, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-methoxyethenyl)-3,3-dimethylcyclohexan-1-one is sourced from PubChem (CID 24972428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).