About 2,4-diethylfuran-3-one
2,4-diethylfuran-3-one (PubChem CID 24972499) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is 2,4-diethylfuran-3-one.
Molecular Properties
| Compound Name | 2,4-diethylfuran-3-one |
| PubChem CID | 24972499 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 2,4-diethylfuran-3-one |
| SMILES | CCC1=COC(CC)C1=O |
| InChI | InChI=1S/C8H12O2/c1-3-6-5-10-7(4-2)8(6)9/h5,7H,3-4H2,1-2H3 |
| InChIKey | CVVJCRKYOBXKQG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-diethylfuran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diethylfuran-3-one?
The IUPAC name of 2,4-diethylfuran-3-one (CID 24972499) is 2,4-diethylfuran-3-one.
What is the SMILES notation for 2,4-diethylfuran-3-one?
The canonical SMILES for 2,4-diethylfuran-3-one is CCC1=COC(CC)C1=O.
What is the InChIKey of 2,4-diethylfuran-3-one?
The InChIKey is CVVJCRKYOBXKQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2/c1-3-6-5-10-7(4-2)8(6)9/h5,7H,3-4H2,1-2H3.
What are the key properties of 2,4-diethylfuran-3-one?
2,4-diethylfuran-3-one has a molecular weight of 140.18 g/mol, XLogP of 1.66, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diethylfuran-3-one is sourced from PubChem (CID 24972499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).