C19H37B — CID 24972641
bis[(E)-hex-1-enyl]-(2,3,3-trimethylbutan-2-yl)borane (PubChem CID 24972641) has the molecular formula C19H37B and a molecular weight of 276.32 g/mol. Its IUPAC name is bis[(E)-hex-1-enyl]-(2,3,3-trimethylbutan-2-yl)borane.
| Compound Name | bis[(E)-hex-1-enyl]-(2,3,3-trimethylbutan-2-yl)borane |
|---|---|
| PubChem CID | 24972641 |
| Molecular Formula | C19H37B |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.30 |
| IUPAC Name | bis[(E)-hex-1-enyl]-(2,3,3-trimethylbutan-2-yl)borane |
| SMILES | CCCC/C=C/B(/C=C/CCCC)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H37B/c1-8-10-12-14-16-20(17-15-13-11-9-2)19(6,7)18(3,4)5/h14-17H,8-13H2,1-7H3/b16-14+,17-15+ |
| InChIKey | AARCCQPMYSOAGO-YXLFCKQPSA-N |
| XLogP | 6.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|