About (6Z)-6-hydrazinylidenebicyclo[9.2.2]pentadeca-1(13),11,14-trien-5-one
(6Z)-6-hydrazinylidenebicyclo[9.2.2]pentadeca-1(13),11,14-trien-5-one (PubChem CID 24972727) has the molecular formula C15H20N2O
and a molecular weight of 244.34 g/mol. Its IUPAC name is (6Z)-6-hydrazinylidenebicyclo[9.2.2]pentadeca-1(13),11,14-trien-5-one.
Molecular Properties
| Compound Name | (6Z)-6-hydrazinylidenebicyclo[9.2.2]pentadeca-1(13),11,14-trien-5-one |
| PubChem CID | 24972727 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (6Z)-6-hydrazinylidenebicyclo[9.2.2]pentadeca-1(13),11,14-trien-5-one |
| SMILES | N/N=C1/CCCCc2ccc(cc2)CCCC1=O |
| InChI | InChI=1S/C15H20N2O/c16-17-14-6-2-1-4-12-8-10-13(11-9-12)5-3-7-15(14)18/h8-11H,1-7,16H2/b17-14- |
| InChIKey | JWNICPOXVWNINM-VKAVYKQESA-N |
| XLogP | 2.62 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (6Z)-6-hydrazinylidenebicyclo[9.2.2]pentadeca-1(13),11,14-trien-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-6-hydrazinylidenebicyclo[9.2.2]pentadeca-1(13),11,14-trien-5-one?
The IUPAC name of (6Z)-6-hydrazinylidenebicyclo[9.2.2]pentadeca-1(13),11,14-trien-5-one (CID 24972727) is (6Z)-6-hydrazinylidenebicyclo[9.2.2]pentadeca-1(13),11,14-trien-5-one.
What is the SMILES notation for (6Z)-6-hydrazinylidenebicyclo[9.2.2]pentadeca-1(13),11,14-trien-5-one?
The canonical SMILES for (6Z)-6-hydrazinylidenebicyclo[9.2.2]pentadeca-1(13),11,14-trien-5-one is N/N=C1/CCCCc2ccc(cc2)CCCC1=O.
What is the InChIKey of (6Z)-6-hydrazinylidenebicyclo[9.2.2]pentadeca-1(13),11,14-trien-5-one?
The InChIKey is JWNICPOXVWNINM-VKAVYKQESA-N. The full InChI is InChI=1S/C15H20N2O/c16-17-14-6-2-1-4-12-8-10-13(11-9-12)5-3-7-15(14)18/h8-11H,1-7,16H2/b17-14-.
What are the key properties of (6Z)-6-hydrazinylidenebicyclo[9.2.2]pentadeca-1(13),11,14-trien-5-one?
(6Z)-6-hydrazinylidenebicyclo[9.2.2]pentadeca-1(13),11,14-trien-5-one has a molecular weight of 244.34 g/mol, XLogP of 2.62, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-6-hydrazinylidenebicyclo[9.2.2]pentadeca-1(13),11,14-trien-5-one is sourced from PubChem (CID 24972727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).