C8H8ClN5 — CID 24972887
1-(4-chlorophenyl)-1,2,4-triazole-3,5-diamine (PubChem CID 24972887) has the molecular formula C8H8ClN5 and a molecular weight of 209.64 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(4-chlorophenyl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 24972887 |
| Molecular Formula | C8H8ClN5 |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 1-(4-chlorophenyl)-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(N)n(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C8H8ClN5/c9-5-1-3-6(4-2-5)14-8(11)12-7(10)13-14/h1-4H,(H4,10,11,12,13) |
| InChIKey | FVBGFVRCDYMWGA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |