About ethyl N-[2-(2,5-dioxoimidazolidin-4-yl)ethoxy]carbamate
ethyl N-[2-(2,5-dioxoimidazolidin-4-yl)ethoxy]carbamate (PubChem CID 24972922) has the molecular formula C8H13N3O5
and a molecular weight of 231.21 g/mol. Its IUPAC name is ethyl N-[2-(2,5-dioxoimidazolidin-4-yl)ethoxy]carbamate.
Molecular Properties
| Compound Name | ethyl N-[2-(2,5-dioxoimidazolidin-4-yl)ethoxy]carbamate |
| PubChem CID | 24972922 |
| Molecular Formula | C8H13N3O5 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | ethyl N-[2-(2,5-dioxoimidazolidin-4-yl)ethoxy]carbamate |
| SMILES | CCOC(=O)NOCCC1NC(=O)NC1=O |
| InChI | InChI=1S/C8H13N3O5/c1-2-15-8(14)11-16-4-3-5-6(12)10-7(13)9-5/h5H,2-4H2,1H3,(H,11,14)(H2,9,10,12,13) |
| InChIKey | VYPCDECMRZBOJE-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[2-(2,5-dioxoimidazolidin-4-yl)ethoxy]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[2-(2,5-dioxoimidazolidin-4-yl)ethoxy]carbamate?
The IUPAC name of ethyl N-[2-(2,5-dioxoimidazolidin-4-yl)ethoxy]carbamate (CID 24972922) is ethyl N-[2-(2,5-dioxoimidazolidin-4-yl)ethoxy]carbamate.
What is the SMILES notation for ethyl N-[2-(2,5-dioxoimidazolidin-4-yl)ethoxy]carbamate?
The canonical SMILES for ethyl N-[2-(2,5-dioxoimidazolidin-4-yl)ethoxy]carbamate is CCOC(=O)NOCCC1NC(=O)NC1=O.
What is the InChIKey of ethyl N-[2-(2,5-dioxoimidazolidin-4-yl)ethoxy]carbamate?
The InChIKey is VYPCDECMRZBOJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O5/c1-2-15-8(14)11-16-4-3-5-6(12)10-7(13)9-5/h5H,2-4H2,1H3,(H,11,14)(H2,9,10,12,13).
What are the key properties of ethyl N-[2-(2,5-dioxoimidazolidin-4-yl)ethoxy]carbamate?
ethyl N-[2-(2,5-dioxoimidazolidin-4-yl)ethoxy]carbamate has a molecular weight of 231.21 g/mol, XLogP of -0.74, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[2-(2,5-dioxoimidazolidin-4-yl)ethoxy]carbamate is sourced from PubChem (CID 24972922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).