About tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-one
tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-one (PubChem CID 24972989) has the molecular formula C11H10O
and a molecular weight of 158.20 g/mol. Its IUPAC name is tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-one.
Molecular Properties
| Compound Name | tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-one |
| PubChem CID | 24972989 |
| Molecular Formula | C11H10O |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-one |
| SMILES | O=C1CC2CCc3cccc1c32 |
| InChI | InChI=1S/C11H10O/c12-10-6-8-5-4-7-2-1-3-9(10)11(7)8/h1-3,8H,4-6H2 |
| InChIKey | QFSGONQWPYGZFS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-one?
The IUPAC name of tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-one (CID 24972989) is tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-one.
What is the SMILES notation for tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-one?
The canonical SMILES for tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-one is O=C1CC2CCc3cccc1c32.
What is the InChIKey of tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-one?
The InChIKey is QFSGONQWPYGZFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O/c12-10-6-8-5-4-7-2-1-3-9(10)11(7)8/h1-3,8H,4-6H2.
What are the key properties of tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-one?
tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-one has a molecular weight of 158.20 g/mol, XLogP of 2.30, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-one is sourced from PubChem (CID 24972989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).