C17H24O2 — CID 24973163
2,8-dimethoxy-4a-methyl-2,3,4,9,10,10a-hexahydro-1H-phenanthrene (PubChem CID 24973163) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 2,8-dimethoxy-4a-methyl-2,3,4,9,10,10a-hexahydro-1H-phenanthrene.
| Compound Name | 2,8-dimethoxy-4a-methyl-2,3,4,9,10,10a-hexahydro-1H-phenanthrene |
|---|---|
| PubChem CID | 24973163 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 2,8-dimethoxy-4a-methyl-2,3,4,9,10,10a-hexahydro-1H-phenanthrene |
| SMILES | COc1cccc2c1CCC1CC(OC)CCC21C |
| InChI | InChI=1S/C17H24O2/c1-17-10-9-13(18-2)11-12(17)7-8-14-15(17)5-4-6-16(14)19-3/h4-6,12-13H,7-11H2,1-3H3 |
| InChIKey | GYOOVBSQTLLARP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |