About 2-amino-6-methyl-2,3-dihydroinden-1-one
2-amino-6-methyl-2,3-dihydroinden-1-one (PubChem CID 24973373) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is 2-amino-6-methyl-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 2-amino-6-methyl-2,3-dihydroinden-1-one |
| PubChem CID | 24973373 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 2-amino-6-methyl-2,3-dihydroinden-1-one |
| SMILES | Cc1ccc2c(c1)C(=O)C(N)C2 |
| InChI | InChI=1S/C10H11NO/c1-6-2-3-7-5-9(11)10(12)8(7)4-6/h2-4,9H,5,11H2,1H3 |
| InChIKey | RJBKEPLOZLLISJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-6-methyl-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-methyl-2,3-dihydroinden-1-one?
The IUPAC name of 2-amino-6-methyl-2,3-dihydroinden-1-one (CID 24973373) is 2-amino-6-methyl-2,3-dihydroinden-1-one.
What is the SMILES notation for 2-amino-6-methyl-2,3-dihydroinden-1-one?
The canonical SMILES for 2-amino-6-methyl-2,3-dihydroinden-1-one is Cc1ccc2c(c1)C(=O)C(N)C2.
What is the InChIKey of 2-amino-6-methyl-2,3-dihydroinden-1-one?
The InChIKey is RJBKEPLOZLLISJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO/c1-6-2-3-7-5-9(11)10(12)8(7)4-6/h2-4,9H,5,11H2,1H3.
What are the key properties of 2-amino-6-methyl-2,3-dihydroinden-1-one?
2-amino-6-methyl-2,3-dihydroinden-1-one has a molecular weight of 161.20 g/mol, XLogP of 1.06, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-methyl-2,3-dihydroinden-1-one is sourced from PubChem (CID 24973373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).