C6H6F4 — CID 24973613
(2Z,4Z)-2,3,4,5-tetrafluorohexa-2,4-diene (PubChem CID 24973613) has the molecular formula C6H6F4 and a molecular weight of 154.11 g/mol. Its IUPAC name is (2Z,4Z)-2,3,4,5-tetrafluorohexa-2,4-diene.
| Compound Name | (2Z,4Z)-2,3,4,5-tetrafluorohexa-2,4-diene |
|---|---|
| PubChem CID | 24973613 |
| Molecular Formula | C6H6F4 |
| Molecular Weight | 154.11 g/mol |
| Exact Mass | 154.04 |
| IUPAC Name | (2Z,4Z)-2,3,4,5-tetrafluorohexa-2,4-diene |
| SMILES | C/C(F)=C(F)\C(F)=C(/C)F |
| InChI | InChI=1S/C6H6F4/c1-3(7)5(9)6(10)4(2)8/h1-2H3/b5-3-,6-4- |
| InChIKey | RNRACOPWBKSUCV-GLIMQPGKSA-N |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.11 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|