About (11E)-6,10-dimethoxy-1-oxacyclotetradec-11-ene-2,7-dione
(11E)-6,10-dimethoxy-1-oxacyclotetradec-11-ene-2,7-dione (PubChem CID 24973617) has the molecular formula C15H24O5
and a molecular weight of 284.35 g/mol. Its IUPAC name is (11E)-6,10-dimethoxy-1-oxacyclotetradec-11-ene-2,7-dione.
Molecular Properties
| Compound Name | (11E)-6,10-dimethoxy-1-oxacyclotetradec-11-ene-2,7-dione |
| PubChem CID | 24973617 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (11E)-6,10-dimethoxy-1-oxacyclotetradec-11-ene-2,7-dione |
| SMILES | COC1/C=C/CCOC(=O)CCCC(OC)C(=O)CC1 |
| InChI | InChI=1S/C15H24O5/c1-18-12-6-3-4-11-20-15(17)8-5-7-14(19-2)13(16)10-9-12/h3,6,12,14H,4-5,7-11H2,1-2H3/b6-3+ |
| InChIKey | LYHSKDMBEFXXHC-ZZXKWVIFSA-N |
| XLogP | 2.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (11E)-6,10-dimethoxy-1-oxacyclotetradec-11-ene-2,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (11E)-6,10-dimethoxy-1-oxacyclotetradec-11-ene-2,7-dione?
The IUPAC name of (11E)-6,10-dimethoxy-1-oxacyclotetradec-11-ene-2,7-dione (CID 24973617) is (11E)-6,10-dimethoxy-1-oxacyclotetradec-11-ene-2,7-dione.
What is the SMILES notation for (11E)-6,10-dimethoxy-1-oxacyclotetradec-11-ene-2,7-dione?
The canonical SMILES for (11E)-6,10-dimethoxy-1-oxacyclotetradec-11-ene-2,7-dione is COC1/C=C/CCOC(=O)CCCC(OC)C(=O)CC1.
What is the InChIKey of (11E)-6,10-dimethoxy-1-oxacyclotetradec-11-ene-2,7-dione?
The InChIKey is LYHSKDMBEFXXHC-ZZXKWVIFSA-N. The full InChI is InChI=1S/C15H24O5/c1-18-12-6-3-4-11-20-15(17)8-5-7-14(19-2)13(16)10-9-12/h3,6,12,14H,4-5,7-11H2,1-2H3/b6-3+.
What are the key properties of (11E)-6,10-dimethoxy-1-oxacyclotetradec-11-ene-2,7-dione?
(11E)-6,10-dimethoxy-1-oxacyclotetradec-11-ene-2,7-dione has a molecular weight of 284.35 g/mol, XLogP of 2.04, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (11E)-6,10-dimethoxy-1-oxacyclotetradec-11-ene-2,7-dione is sourced from PubChem (CID 24973617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).