C9H10O3 — CID 24973686
4-hydroxy-3-methylidene-5,6,7,7a-tetrahydro-1-benzofuran-2-one (PubChem CID 24973686) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is 4-hydroxy-3-methylidene-5,6,7,7a-tetrahydro-1-benzofuran-2-one.
| Compound Name | 4-hydroxy-3-methylidene-5,6,7,7a-tetrahydro-1-benzofuran-2-one |
|---|---|
| PubChem CID | 24973686 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 4-hydroxy-3-methylidene-5,6,7,7a-tetrahydro-1-benzofuran-2-one |
| SMILES | C=C1C(=O)OC2CCCC(O)=C12 |
| InChI | InChI=1S/C9H10O3/c1-5-8-6(10)3-2-4-7(8)12-9(5)11/h7,10H,1-4H2 |
| InChIKey | NMNBKLZVZUCNHP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|