C8H16OS2 — CID 24973882
(E)-4,6-bis(methylsulfanyl)hex-5-en-3-ol (PubChem CID 24973882) has the molecular formula C8H16OS2 and a molecular weight of 192.35 g/mol. Its IUPAC name is (E)-4,6-bis(methylsulfanyl)hex-5-en-3-ol.
| Compound Name | (E)-4,6-bis(methylsulfanyl)hex-5-en-3-ol |
|---|---|
| PubChem CID | 24973882 |
| Molecular Formula | C8H16OS2 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | (E)-4,6-bis(methylsulfanyl)hex-5-en-3-ol |
| SMILES | CCC(O)C(/C=C/SC)SC |
| InChI | InChI=1S/C8H16OS2/c1-4-7(9)8(11-3)5-6-10-2/h5-9H,4H2,1-3H3/b6-5+ |
| InChIKey | ICCXUBLLXKAWGM-AATRIKPKSA-N |
| XLogP | 2.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |