About 6-chloro-5H-benzo[c][1,2]benzazaborinine
6-chloro-5H-benzo[c][1,2]benzazaborinine (PubChem CID 24973895) has the molecular formula C12H9BClN
and a molecular weight of 213.48 g/mol. Its IUPAC name is 6-chloro-5H-benzo[c][1,2]benzazaborinine.
Molecular Properties
| Compound Name | 6-chloro-5H-benzo[c][1,2]benzazaborinine |
| PubChem CID | 24973895 |
| Molecular Formula | C12H9BClN |
| Molecular Weight | 213.48 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 6-chloro-5H-benzo[c][1,2]benzazaborinine |
| SMILES | ClB1Nc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C12H9BClN/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)15-13/h1-8,15H |
| InChIKey | GRNXYFFVBSYCLQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-5H-benzo[c][1,2]benzazaborinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-5H-benzo[c][1,2]benzazaborinine?
The IUPAC name of 6-chloro-5H-benzo[c][1,2]benzazaborinine (CID 24973895) is 6-chloro-5H-benzo[c][1,2]benzazaborinine.
What is the SMILES notation for 6-chloro-5H-benzo[c][1,2]benzazaborinine?
The canonical SMILES for 6-chloro-5H-benzo[c][1,2]benzazaborinine is ClB1Nc2ccccc2-c2ccccc21.
What is the InChIKey of 6-chloro-5H-benzo[c][1,2]benzazaborinine?
The InChIKey is GRNXYFFVBSYCLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BClN/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)15-13/h1-8,15H.
What are the key properties of 6-chloro-5H-benzo[c][1,2]benzazaborinine?
6-chloro-5H-benzo[c][1,2]benzazaborinine has a molecular weight of 213.48 g/mol, XLogP of 2.71, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-5H-benzo[c][1,2]benzazaborinine is sourced from PubChem (CID 24973895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).