About 2,4,5-tripropyl-1H-imidazole
2,4,5-tripropyl-1H-imidazole (PubChem CID 24974633) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is 2,4,5-tripropyl-1H-imidazole.
Molecular Properties
| Compound Name | 2,4,5-tripropyl-1H-imidazole |
| PubChem CID | 24974633 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 2,4,5-tripropyl-1H-imidazole |
| SMILES | CCCc1nc(CCC)c(CCC)[nH]1 |
| InChI | InChI=1S/C12H22N2/c1-4-7-10-11(8-5-2)14-12(13-10)9-6-3/h4-9H2,1-3H3,(H,13,14) |
| InChIKey | HABWCGHILPWHDG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4,5-tripropyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,5-tripropyl-1H-imidazole?
The IUPAC name of 2,4,5-tripropyl-1H-imidazole (CID 24974633) is 2,4,5-tripropyl-1H-imidazole.
What is the SMILES notation for 2,4,5-tripropyl-1H-imidazole?
The canonical SMILES for 2,4,5-tripropyl-1H-imidazole is CCCc1nc(CCC)c(CCC)[nH]1.
What is the InChIKey of 2,4,5-tripropyl-1H-imidazole?
The InChIKey is HABWCGHILPWHDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2/c1-4-7-10-11(8-5-2)14-12(13-10)9-6-3/h4-9H2,1-3H3,(H,13,14).
What are the key properties of 2,4,5-tripropyl-1H-imidazole?
2,4,5-tripropyl-1H-imidazole has a molecular weight of 194.32 g/mol, XLogP of 3.27, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5-tripropyl-1H-imidazole is sourced from PubChem (CID 24974633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).