C10H14Br2 — CID 24974975
(2E,4E,6E)-1,8-dibromo-2,7-dimethylocta-2,4,6-triene (PubChem CID 24974975) has the molecular formula C10H14Br2 and a molecular weight of 294.03 g/mol. Its IUPAC name is (2E,4E,6E)-1,8-dibromo-2,7-dimethylocta-2,4,6-triene.
| Compound Name | (2E,4E,6E)-1,8-dibromo-2,7-dimethylocta-2,4,6-triene |
|---|---|
| PubChem CID | 24974975 |
| Molecular Formula | C10H14Br2 |
| Molecular Weight | 294.03 g/mol |
| Exact Mass | 291.95 |
| IUPAC Name | (2E,4E,6E)-1,8-dibromo-2,7-dimethylocta-2,4,6-triene |
| SMILES | C/C(=C\C=C\C=C(/C)CBr)CBr |
| InChI | InChI=1S/C10H14Br2/c1-9(7-11)5-3-4-6-10(2)8-12/h3-6H,7-8H2,1-2H3/b4-3+,9-5+,10-6+ |
| InChIKey | SDFNLBAGUUMXTA-XLKYRCCQSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.03 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|