C14H24O2 — CID 24975354
(3E)-3-heptylidene-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran (PubChem CID 24975354) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is (3E)-3-heptylidene-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran.
| Compound Name | (3E)-3-heptylidene-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran |
|---|---|
| PubChem CID | 24975354 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (3E)-3-heptylidene-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran |
| SMILES | CCCCCC/C=C1/COC2OCCCC12 |
| InChI | InChI=1S/C14H24O2/c1-2-3-4-5-6-8-12-11-16-14-13(12)9-7-10-15-14/h8,13-14H,2-7,9-11H2,1H3/b12-8- |
| InChIKey | CNJPZECWXSVBKN-WQLSENKSSA-N |
| XLogP | 3.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|