About 6-(hydroxymethyl)-3,6-dimethyl-5,7-dihydro-1-benzofuran-4-one
6-(hydroxymethyl)-3,6-dimethyl-5,7-dihydro-1-benzofuran-4-one (PubChem CID 24975392) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is 6-(hydroxymethyl)-3,6-dimethyl-5,7-dihydro-1-benzofuran-4-one.
Molecular Properties
| Compound Name | 6-(hydroxymethyl)-3,6-dimethyl-5,7-dihydro-1-benzofuran-4-one |
| PubChem CID | 24975392 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 6-(hydroxymethyl)-3,6-dimethyl-5,7-dihydro-1-benzofuran-4-one |
| SMILES | Cc1coc2c1C(=O)CC(C)(CO)C2 |
| InChI | InChI=1S/C11H14O3/c1-7-5-14-9-4-11(2,6-12)3-8(13)10(7)9/h5,12H,3-4,6H2,1-2H3 |
| InChIKey | HFUVFOZKJKFZAP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(hydroxymethyl)-3,6-dimethyl-5,7-dihydro-1-benzofuran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(hydroxymethyl)-3,6-dimethyl-5,7-dihydro-1-benzofuran-4-one?
The IUPAC name of 6-(hydroxymethyl)-3,6-dimethyl-5,7-dihydro-1-benzofuran-4-one (CID 24975392) is 6-(hydroxymethyl)-3,6-dimethyl-5,7-dihydro-1-benzofuran-4-one.
What is the SMILES notation for 6-(hydroxymethyl)-3,6-dimethyl-5,7-dihydro-1-benzofuran-4-one?
The canonical SMILES for 6-(hydroxymethyl)-3,6-dimethyl-5,7-dihydro-1-benzofuran-4-one is Cc1coc2c1C(=O)CC(C)(CO)C2.
What is the InChIKey of 6-(hydroxymethyl)-3,6-dimethyl-5,7-dihydro-1-benzofuran-4-one?
The InChIKey is HFUVFOZKJKFZAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-7-5-14-9-4-11(2,6-12)3-8(13)10(7)9/h5,12H,3-4,6H2,1-2H3.
What are the key properties of 6-(hydroxymethyl)-3,6-dimethyl-5,7-dihydro-1-benzofuran-4-one?
6-(hydroxymethyl)-3,6-dimethyl-5,7-dihydro-1-benzofuran-4-one has a molecular weight of 194.23 g/mol, XLogP of 1.72, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(hydroxymethyl)-3,6-dimethyl-5,7-dihydro-1-benzofuran-4-one is sourced from PubChem (CID 24975392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).