About 2,3-dihydroindol-5-one
2,3-dihydroindol-5-one (PubChem CID 24975429) has the molecular formula C8H7NO
and a molecular weight of 133.15 g/mol. Its IUPAC name is 2,3-dihydroindol-5-one.
Molecular Properties
| Compound Name | 2,3-dihydroindol-5-one |
| PubChem CID | 24975429 |
| Molecular Formula | C8H7NO |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.05 |
| IUPAC Name | 2,3-dihydroindol-5-one |
| SMILES | O=C1C=CC2=NCCC2=C1 |
| InChI | InChI=1S/C8H7NO/c10-7-1-2-8-6(5-7)3-4-9-8/h1-2,5H,3-4H2 |
| InChIKey | UTPPPSHHZKMGEI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydroindol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroindol-5-one?
The IUPAC name of 2,3-dihydroindol-5-one (CID 24975429) is 2,3-dihydroindol-5-one.
What is the SMILES notation for 2,3-dihydroindol-5-one?
The canonical SMILES for 2,3-dihydroindol-5-one is O=C1C=CC2=NCCC2=C1.
What is the InChIKey of 2,3-dihydroindol-5-one?
The InChIKey is UTPPPSHHZKMGEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO/c10-7-1-2-8-6(5-7)3-4-9-8/h1-2,5H,3-4H2.
What are the key properties of 2,3-dihydroindol-5-one?
2,3-dihydroindol-5-one has a molecular weight of 133.15 g/mol, XLogP of 0.90, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroindol-5-one is sourced from PubChem (CID 24975429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).