About 1-methyl-5-pyrrolidin-1-yl-3,4-dihydro-2H-pyridine
1-methyl-5-pyrrolidin-1-yl-3,4-dihydro-2H-pyridine (PubChem CID 24976483) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 1-methyl-5-pyrrolidin-1-yl-3,4-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1-methyl-5-pyrrolidin-1-yl-3,4-dihydro-2H-pyridine |
| PubChem CID | 24976483 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1-methyl-5-pyrrolidin-1-yl-3,4-dihydro-2H-pyridine |
| SMILES | CN1C=C(N2CCCC2)CCC1 |
| InChI | InChI=1S/C10H18N2/c1-11-6-4-5-10(9-11)12-7-2-3-8-12/h9H,2-8H2,1H3 |
| InChIKey | DGBDYRCTNUMDIO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-5-pyrrolidin-1-yl-3,4-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5-pyrrolidin-1-yl-3,4-dihydro-2H-pyridine?
The IUPAC name of 1-methyl-5-pyrrolidin-1-yl-3,4-dihydro-2H-pyridine (CID 24976483) is 1-methyl-5-pyrrolidin-1-yl-3,4-dihydro-2H-pyridine.
What is the SMILES notation for 1-methyl-5-pyrrolidin-1-yl-3,4-dihydro-2H-pyridine?
The canonical SMILES for 1-methyl-5-pyrrolidin-1-yl-3,4-dihydro-2H-pyridine is CN1C=C(N2CCCC2)CCC1.
What is the InChIKey of 1-methyl-5-pyrrolidin-1-yl-3,4-dihydro-2H-pyridine?
The InChIKey is DGBDYRCTNUMDIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-11-6-4-5-10(9-11)12-7-2-3-8-12/h9H,2-8H2,1H3.
What are the key properties of 1-methyl-5-pyrrolidin-1-yl-3,4-dihydro-2H-pyridine?
1-methyl-5-pyrrolidin-1-yl-3,4-dihydro-2H-pyridine has a molecular weight of 166.27 g/mol, XLogP of 1.65, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5-pyrrolidin-1-yl-3,4-dihydro-2H-pyridine is sourced from PubChem (CID 24976483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).