About (6Z)-2,2-dimethyl-6-(propan-2-yloxymethylidene)cyclohexan-1-one
(6Z)-2,2-dimethyl-6-(propan-2-yloxymethylidene)cyclohexan-1-one (PubChem CID 24976596) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is (6Z)-2,2-dimethyl-6-(propan-2-yloxymethylidene)cyclohexan-1-one.
Molecular Properties
| Compound Name | (6Z)-2,2-dimethyl-6-(propan-2-yloxymethylidene)cyclohexan-1-one |
| PubChem CID | 24976596 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (6Z)-2,2-dimethyl-6-(propan-2-yloxymethylidene)cyclohexan-1-one |
| SMILES | CC(C)O/C=C1/CCCC(C)(C)C1=O |
| InChI | InChI=1S/C12H20O2/c1-9(2)14-8-10-6-5-7-12(3,4)11(10)13/h8-9H,5-7H2,1-4H3/b10-8- |
| InChIKey | DEGZLYXEPARTGU-NTMALXAHSA-N |
| XLogP | 3.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (6Z)-2,2-dimethyl-6-(propan-2-yloxymethylidene)cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-2,2-dimethyl-6-(propan-2-yloxymethylidene)cyclohexan-1-one?
The IUPAC name of (6Z)-2,2-dimethyl-6-(propan-2-yloxymethylidene)cyclohexan-1-one (CID 24976596) is (6Z)-2,2-dimethyl-6-(propan-2-yloxymethylidene)cyclohexan-1-one.
What is the SMILES notation for (6Z)-2,2-dimethyl-6-(propan-2-yloxymethylidene)cyclohexan-1-one?
The canonical SMILES for (6Z)-2,2-dimethyl-6-(propan-2-yloxymethylidene)cyclohexan-1-one is CC(C)O/C=C1/CCCC(C)(C)C1=O.
What is the InChIKey of (6Z)-2,2-dimethyl-6-(propan-2-yloxymethylidene)cyclohexan-1-one?
The InChIKey is DEGZLYXEPARTGU-NTMALXAHSA-N. The full InChI is InChI=1S/C12H20O2/c1-9(2)14-8-10-6-5-7-12(3,4)11(10)13/h8-9H,5-7H2,1-4H3/b10-8-.
What are the key properties of (6Z)-2,2-dimethyl-6-(propan-2-yloxymethylidene)cyclohexan-1-one?
(6Z)-2,2-dimethyl-6-(propan-2-yloxymethylidene)cyclohexan-1-one has a molecular weight of 196.29 g/mol, XLogP of 3.07, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-2,2-dimethyl-6-(propan-2-yloxymethylidene)cyclohexan-1-one is sourced from PubChem (CID 24976596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).