C12H13NO3 — CID 24976673
(2-phenyl-4,5-dihydro-1,3-oxazol-5-yl)methyl acetate (PubChem CID 24976673) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is (2-phenyl-4,5-dihydro-1,3-oxazol-5-yl)methyl acetate.
| Compound Name | (2-phenyl-4,5-dihydro-1,3-oxazol-5-yl)methyl acetate |
|---|---|
| PubChem CID | 24976673 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (2-phenyl-4,5-dihydro-1,3-oxazol-5-yl)methyl acetate |
| SMILES | CC(=O)OCC1CN=C(c2ccccc2)O1 |
| InChI | InChI=1S/C12H13NO3/c1-9(14)15-8-11-7-13-12(16-11)10-5-3-2-4-6-10/h2-6,11H,7-8H2,1H3 |
| InChIKey | GQDSKXZRBMERHE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |