About 6-tert-butylsulfanyl-2,2-dimethylhexan-3-ol
6-tert-butylsulfanyl-2,2-dimethylhexan-3-ol (PubChem CID 24976738) has the molecular formula C12H26OS
and a molecular weight of 218.41 g/mol. Its IUPAC name is 6-tert-butylsulfanyl-2,2-dimethylhexan-3-ol.
Molecular Properties
| Compound Name | 6-tert-butylsulfanyl-2,2-dimethylhexan-3-ol |
| PubChem CID | 24976738 |
| Molecular Formula | C12H26OS |
| Molecular Weight | 218.41 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 6-tert-butylsulfanyl-2,2-dimethylhexan-3-ol |
| SMILES | CC(C)(C)SCCCC(O)C(C)(C)C |
| InChI | InChI=1S/C12H26OS/c1-11(2,3)10(13)8-7-9-14-12(4,5)6/h10,13H,7-9H2,1-6H3 |
| InChIKey | AOBVGDPXQPGXQP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-tert-butylsulfanyl-2,2-dimethylhexan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butylsulfanyl-2,2-dimethylhexan-3-ol?
The IUPAC name of 6-tert-butylsulfanyl-2,2-dimethylhexan-3-ol (CID 24976738) is 6-tert-butylsulfanyl-2,2-dimethylhexan-3-ol.
What is the SMILES notation for 6-tert-butylsulfanyl-2,2-dimethylhexan-3-ol?
The canonical SMILES for 6-tert-butylsulfanyl-2,2-dimethylhexan-3-ol is CC(C)(C)SCCCC(O)C(C)(C)C.
What is the InChIKey of 6-tert-butylsulfanyl-2,2-dimethylhexan-3-ol?
The InChIKey is AOBVGDPXQPGXQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26OS/c1-11(2,3)10(13)8-7-9-14-12(4,5)6/h10,13H,7-9H2,1-6H3.
What are the key properties of 6-tert-butylsulfanyl-2,2-dimethylhexan-3-ol?
6-tert-butylsulfanyl-2,2-dimethylhexan-3-ol has a molecular weight of 218.41 g/mol, XLogP of 3.71, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butylsulfanyl-2,2-dimethylhexan-3-ol is sourced from PubChem (CID 24976738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).