About methyl 5-formyl-1,2-oxazole-3-carboxylate
methyl 5-formyl-1,2-oxazole-3-carboxylate (PubChem CID 24976859) has the molecular formula C6H5NO4
and a molecular weight of 155.11 g/mol. Its IUPAC name is methyl 5-formyl-1,2-oxazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-formyl-1,2-oxazole-3-carboxylate |
| PubChem CID | 24976859 |
| Molecular Formula | C6H5NO4 |
| Molecular Weight | 155.11 g/mol |
| Exact Mass | 155.02 |
| IUPAC Name | methyl 5-formyl-1,2-oxazole-3-carboxylate |
| SMILES | COC(=O)c1cc(C=O)on1 |
| InChI | InChI=1S/C6H5NO4/c1-10-6(9)5-2-4(3-8)11-7-5/h2-3H,1H3 |
| InChIKey | RSOKVJLXFFQLLB-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.11 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-formyl-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-formyl-1,2-oxazole-3-carboxylate?
The IUPAC name of methyl 5-formyl-1,2-oxazole-3-carboxylate (CID 24976859) is methyl 5-formyl-1,2-oxazole-3-carboxylate.
What is the SMILES notation for methyl 5-formyl-1,2-oxazole-3-carboxylate?
The canonical SMILES for methyl 5-formyl-1,2-oxazole-3-carboxylate is COC(=O)c1cc(C=O)on1.
What is the InChIKey of methyl 5-formyl-1,2-oxazole-3-carboxylate?
The InChIKey is RSOKVJLXFFQLLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO4/c1-10-6(9)5-2-4(3-8)11-7-5/h2-3H,1H3.
What are the key properties of methyl 5-formyl-1,2-oxazole-3-carboxylate?
methyl 5-formyl-1,2-oxazole-3-carboxylate has a molecular weight of 155.11 g/mol, XLogP of 0.27, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-formyl-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 24976859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).