About (5-acetyloxydispiro[2.2.26.23]deca-4,9-dien-10-yl) acetate
(5-acetyloxydispiro[2.2.26.23]deca-4,9-dien-10-yl) acetate (PubChem CID 24976993) has the molecular formula C14H16O4
and a molecular weight of 248.28 g/mol. Its IUPAC name is (5-acetyloxydispiro[2.2.26.23]deca-4,9-dien-10-yl) acetate.
Molecular Properties
| Compound Name | (5-acetyloxydispiro[2.2.26.23]deca-4,9-dien-10-yl) acetate |
| PubChem CID | 24976993 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (5-acetyloxydispiro[2.2.26.23]deca-4,9-dien-10-yl) acetate |
| SMILES | CC(=O)OC1=CC2(CC2)C(OC(C)=O)=CC12CC2 |
| InChI | InChI=1S/C14H16O4/c1-9(15)17-11-7-14(5-6-14)12(18-10(2)16)8-13(11)3-4-13/h7-8H,3-6H2,1-2H3 |
| InChIKey | QZYXFXGWCLYNSQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-acetyloxydispiro[2.2.26.23]deca-4,9-dien-10-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-acetyloxydispiro[2.2.26.23]deca-4,9-dien-10-yl) acetate?
The IUPAC name of (5-acetyloxydispiro[2.2.26.23]deca-4,9-dien-10-yl) acetate (CID 24976993) is (5-acetyloxydispiro[2.2.26.23]deca-4,9-dien-10-yl) acetate.
What is the SMILES notation for (5-acetyloxydispiro[2.2.26.23]deca-4,9-dien-10-yl) acetate?
The canonical SMILES for (5-acetyloxydispiro[2.2.26.23]deca-4,9-dien-10-yl) acetate is CC(=O)OC1=CC2(CC2)C(OC(C)=O)=CC12CC2.
What is the InChIKey of (5-acetyloxydispiro[2.2.26.23]deca-4,9-dien-10-yl) acetate?
The InChIKey is QZYXFXGWCLYNSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O4/c1-9(15)17-11-7-14(5-6-14)12(18-10(2)16)8-13(11)3-4-13/h7-8H,3-6H2,1-2H3.
What are the key properties of (5-acetyloxydispiro[2.2.26.23]deca-4,9-dien-10-yl) acetate?
(5-acetyloxydispiro[2.2.26.23]deca-4,9-dien-10-yl) acetate has a molecular weight of 248.28 g/mol, XLogP of 2.45, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-acetyloxydispiro[2.2.26.23]deca-4,9-dien-10-yl) acetate is sourced from PubChem (CID 24976993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).