About 6-bromo-5,8-dimethylisoquinoline
6-bromo-5,8-dimethylisoquinoline (PubChem CID 24977078) has the molecular formula C11H10BrN
and a molecular weight of 236.11 g/mol. Its IUPAC name is 6-bromo-5,8-dimethylisoquinoline.
Molecular Properties
| Compound Name | 6-bromo-5,8-dimethylisoquinoline |
| PubChem CID | 24977078 |
| Molecular Formula | C11H10BrN |
| Molecular Weight | 236.11 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | 6-bromo-5,8-dimethylisoquinoline |
| SMILES | Cc1cc(Br)c(C)c2ccncc12 |
| InChI | InChI=1S/C11H10BrN/c1-7-5-11(12)8(2)9-3-4-13-6-10(7)9/h3-6H,1-2H3 |
| InChIKey | NERWMFUPLXLMPI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.11 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-5,8-dimethylisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-5,8-dimethylisoquinoline?
The IUPAC name of 6-bromo-5,8-dimethylisoquinoline (CID 24977078) is 6-bromo-5,8-dimethylisoquinoline.
What is the SMILES notation for 6-bromo-5,8-dimethylisoquinoline?
The canonical SMILES for 6-bromo-5,8-dimethylisoquinoline is Cc1cc(Br)c(C)c2ccncc12.
What is the InChIKey of 6-bromo-5,8-dimethylisoquinoline?
The InChIKey is NERWMFUPLXLMPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrN/c1-7-5-11(12)8(2)9-3-4-13-6-10(7)9/h3-6H,1-2H3.
What are the key properties of 6-bromo-5,8-dimethylisoquinoline?
6-bromo-5,8-dimethylisoquinoline has a molecular weight of 236.11 g/mol, XLogP of 3.61, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-5,8-dimethylisoquinoline is sourced from PubChem (CID 24977078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).