C14H20O4 — CID 24977269
3,3,7,11,11-pentamethyl-2,4-dioxaspiro[5.5]undec-8-ene-1,5-dione (PubChem CID 24977269) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 3,3,7,11,11-pentamethyl-2,4-dioxaspiro[5.5]undec-8-ene-1,5-dione.
| Compound Name | 3,3,7,11,11-pentamethyl-2,4-dioxaspiro[5.5]undec-8-ene-1,5-dione |
|---|---|
| PubChem CID | 24977269 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 3,3,7,11,11-pentamethyl-2,4-dioxaspiro[5.5]undec-8-ene-1,5-dione |
| SMILES | CC1C=CCC(C)(C)C12C(=O)OC(C)(C)OC2=O |
| InChI | InChI=1S/C14H20O4/c1-9-7-6-8-12(2,3)14(9)10(15)17-13(4,5)18-11(14)16/h6-7,9H,8H2,1-5H3 |
| InChIKey | OHAHFRQVGBVVKQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|