About 2,6-diethyl-1,2,6-thiadiazinane
2,6-diethyl-1,2,6-thiadiazinane (PubChem CID 24977465) has the molecular formula C7H16N2S
and a molecular weight of 160.29 g/mol. Its IUPAC name is 2,6-diethyl-1,2,6-thiadiazinane.
Molecular Properties
| Compound Name | 2,6-diethyl-1,2,6-thiadiazinane |
| PubChem CID | 24977465 |
| Molecular Formula | C7H16N2S |
| Molecular Weight | 160.29 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 2,6-diethyl-1,2,6-thiadiazinane |
| SMILES | CCN1CCCN(CC)S1 |
| InChI | InChI=1S/C7H16N2S/c1-3-8-6-5-7-9(4-2)10-8/h3-7H2,1-2H3 |
| InChIKey | JUTRMCHQYGZGKX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,6-diethyl-1,2,6-thiadiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diethyl-1,2,6-thiadiazinane?
The IUPAC name of 2,6-diethyl-1,2,6-thiadiazinane (CID 24977465) is 2,6-diethyl-1,2,6-thiadiazinane.
What is the SMILES notation for 2,6-diethyl-1,2,6-thiadiazinane?
The canonical SMILES for 2,6-diethyl-1,2,6-thiadiazinane is CCN1CCCN(CC)S1.
What is the InChIKey of 2,6-diethyl-1,2,6-thiadiazinane?
The InChIKey is JUTRMCHQYGZGKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2S/c1-3-8-6-5-7-9(4-2)10-8/h3-7H2,1-2H3.
What are the key properties of 2,6-diethyl-1,2,6-thiadiazinane?
2,6-diethyl-1,2,6-thiadiazinane has a molecular weight of 160.29 g/mol, XLogP of 1.60, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diethyl-1,2,6-thiadiazinane is sourced from PubChem (CID 24977465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).