C12H12N2O2S — CID 24977477
2,5,6,7-tetramethyl-1,1-dioxothiepine-3,4-dicarbonitrile (PubChem CID 24977477) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 2,5,6,7-tetramethyl-1,1-dioxothiepine-3,4-dicarbonitrile.
| Compound Name | 2,5,6,7-tetramethyl-1,1-dioxothiepine-3,4-dicarbonitrile |
|---|---|
| PubChem CID | 24977477 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 2,5,6,7-tetramethyl-1,1-dioxothiepine-3,4-dicarbonitrile |
| SMILES | CC1=C(C#N)C(C#N)=C(C)S(=O)(=O)C(C)=C1C |
| InChI | InChI=1S/C12H12N2O2S/c1-7-8(2)11(5-13)12(6-14)10(4)17(15,16)9(7)3/h1-4H3 |
| InChIKey | WTWGIRQIVPEEHD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |