About 3-benzyl-2,4-dimethyl-5-phenyl-3H-1,2-oxazole
3-benzyl-2,4-dimethyl-5-phenyl-3H-1,2-oxazole (PubChem CID 24977597) has the molecular formula C18H19NO
and a molecular weight of 265.36 g/mol. Its IUPAC name is 3-benzyl-2,4-dimethyl-5-phenyl-3H-1,2-oxazole.
Molecular Properties
| Compound Name | 3-benzyl-2,4-dimethyl-5-phenyl-3H-1,2-oxazole |
| PubChem CID | 24977597 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 3-benzyl-2,4-dimethyl-5-phenyl-3H-1,2-oxazole |
| SMILES | CC1=C(c2ccccc2)ON(C)C1Cc1ccccc1 |
| InChI | InChI=1S/C18H19NO/c1-14-17(13-15-9-5-3-6-10-15)19(2)20-18(14)16-11-7-4-8-12-16/h3-12,17H,13H2,1-2H3 |
| InChIKey | HAXHURVFBAGYHZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-benzyl-2,4-dimethyl-5-phenyl-3H-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-2,4-dimethyl-5-phenyl-3H-1,2-oxazole?
The IUPAC name of 3-benzyl-2,4-dimethyl-5-phenyl-3H-1,2-oxazole (CID 24977597) is 3-benzyl-2,4-dimethyl-5-phenyl-3H-1,2-oxazole.
What is the SMILES notation for 3-benzyl-2,4-dimethyl-5-phenyl-3H-1,2-oxazole?
The canonical SMILES for 3-benzyl-2,4-dimethyl-5-phenyl-3H-1,2-oxazole is CC1=C(c2ccccc2)ON(C)C1Cc1ccccc1.
What is the InChIKey of 3-benzyl-2,4-dimethyl-5-phenyl-3H-1,2-oxazole?
The InChIKey is HAXHURVFBAGYHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO/c1-14-17(13-15-9-5-3-6-10-15)19(2)20-18(14)16-11-7-4-8-12-16/h3-12,17H,13H2,1-2H3.
What are the key properties of 3-benzyl-2,4-dimethyl-5-phenyl-3H-1,2-oxazole?
3-benzyl-2,4-dimethyl-5-phenyl-3H-1,2-oxazole has a molecular weight of 265.36 g/mol, XLogP of 3.91, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-2,4-dimethyl-5-phenyl-3H-1,2-oxazole is sourced from PubChem (CID 24977597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).