About 10-[3-(dimethylamino)propyl]-9H-anthracene-9,10-diol
10-[3-(dimethylamino)propyl]-9H-anthracene-9,10-diol (PubChem CID 24977688) has the molecular formula C19H23NO2
and a molecular weight of 297.40 g/mol. Its IUPAC name is 10-[3-(dimethylamino)propyl]-9H-anthracene-9,10-diol.
Molecular Properties
| Compound Name | 10-[3-(dimethylamino)propyl]-9H-anthracene-9,10-diol |
| PubChem CID | 24977688 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 10-[3-(dimethylamino)propyl]-9H-anthracene-9,10-diol |
| SMILES | CN(C)CCCC1(O)c2ccccc2C(O)c2ccccc21 |
| InChI | InChI=1S/C19H23NO2/c1-20(2)13-7-12-19(22)16-10-5-3-8-14(16)18(21)15-9-4-6-11-17(15)19/h3-6,8-11,18,21-22H,7,12-13H2,1-2H3 |
| InChIKey | GOTIYLWSHRPFEH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 10-[3-(dimethylamino)propyl]-9H-anthracene-9,10-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-[3-(dimethylamino)propyl]-9H-anthracene-9,10-diol?
The IUPAC name of 10-[3-(dimethylamino)propyl]-9H-anthracene-9,10-diol (CID 24977688) is 10-[3-(dimethylamino)propyl]-9H-anthracene-9,10-diol.
What is the SMILES notation for 10-[3-(dimethylamino)propyl]-9H-anthracene-9,10-diol?
The canonical SMILES for 10-[3-(dimethylamino)propyl]-9H-anthracene-9,10-diol is CN(C)CCCC1(O)c2ccccc2C(O)c2ccccc21.
What is the InChIKey of 10-[3-(dimethylamino)propyl]-9H-anthracene-9,10-diol?
The InChIKey is GOTIYLWSHRPFEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO2/c1-20(2)13-7-12-19(22)16-10-5-3-8-14(16)18(21)15-9-4-6-11-17(15)19/h3-6,8-11,18,21-22H,7,12-13H2,1-2H3.
What are the key properties of 10-[3-(dimethylamino)propyl]-9H-anthracene-9,10-diol?
10-[3-(dimethylamino)propyl]-9H-anthracene-9,10-diol has a molecular weight of 297.40 g/mol, XLogP of 2.66, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-[3-(dimethylamino)propyl]-9H-anthracene-9,10-diol is sourced from PubChem (CID 24977688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).