About 5-[2-(1,3-dithian-2-yl)ethyl]-2,2-dimethyl-1,3-dioxane
5-[2-(1,3-dithian-2-yl)ethyl]-2,2-dimethyl-1,3-dioxane (PubChem CID 24977691) has the molecular formula C12H22O2S2
and a molecular weight of 262.44 g/mol. Its IUPAC name is 5-[2-(1,3-dithian-2-yl)ethyl]-2,2-dimethyl-1,3-dioxane.
Molecular Properties
| Compound Name | 5-[2-(1,3-dithian-2-yl)ethyl]-2,2-dimethyl-1,3-dioxane |
| PubChem CID | 24977691 |
| Molecular Formula | C12H22O2S2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 5-[2-(1,3-dithian-2-yl)ethyl]-2,2-dimethyl-1,3-dioxane |
| SMILES | CC1(C)OCC(CCC2SCCCS2)CO1 |
| InChI | InChI=1S/C12H22O2S2/c1-12(2)13-8-10(9-14-12)4-5-11-15-6-3-7-16-11/h10-11H,3-9H2,1-2H3 |
| InChIKey | SWVYPPFNRYAQIE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[2-(1,3-dithian-2-yl)ethyl]-2,2-dimethyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(1,3-dithian-2-yl)ethyl]-2,2-dimethyl-1,3-dioxane?
The IUPAC name of 5-[2-(1,3-dithian-2-yl)ethyl]-2,2-dimethyl-1,3-dioxane (CID 24977691) is 5-[2-(1,3-dithian-2-yl)ethyl]-2,2-dimethyl-1,3-dioxane.
What is the SMILES notation for 5-[2-(1,3-dithian-2-yl)ethyl]-2,2-dimethyl-1,3-dioxane?
The canonical SMILES for 5-[2-(1,3-dithian-2-yl)ethyl]-2,2-dimethyl-1,3-dioxane is CC1(C)OCC(CCC2SCCCS2)CO1.
What is the InChIKey of 5-[2-(1,3-dithian-2-yl)ethyl]-2,2-dimethyl-1,3-dioxane?
The InChIKey is SWVYPPFNRYAQIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2S2/c1-12(2)13-8-10(9-14-12)4-5-11-15-6-3-7-16-11/h10-11H,3-9H2,1-2H3.
What are the key properties of 5-[2-(1,3-dithian-2-yl)ethyl]-2,2-dimethyl-1,3-dioxane?
5-[2-(1,3-dithian-2-yl)ethyl]-2,2-dimethyl-1,3-dioxane has a molecular weight of 262.44 g/mol, XLogP of 3.36, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(1,3-dithian-2-yl)ethyl]-2,2-dimethyl-1,3-dioxane is sourced from PubChem (CID 24977691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).